A1519712
9-Bromo-7,7-dimethyl-7<i>H</i>-benzo[<i>c</i>]fluorene , 98% , 1198396-46-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB135.20 | In Stock |
|
| 1G | RMB439.20 | In Stock |
|
| 5g | RMB1679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105.0 to 109.0 °C |
| Boiling point: | 445℃ |
| Density | 1.363 |
| Flash point: | 219℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C19H15Br/c1-19(2)16-10-7-12-5-3-4-6-14(12)18(16)15-9-8-13(20)11-17(15)19/h3-11H,1-2H3 |
| InChIKey | SNUKBTHMZLUJKR-UHFFFAOYSA-N |
| SMILES | C1(C)(C)C2=C(C=CC(Br)=C2)C2=C1C=CC1=CC=CC=C12 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 2903.99.8001 |

![9-Bromo-7,7-dimethyl-7<i>H</i>-benzo[<i>c</i>]fluorene](https://img.chemicalbook.com/CAS/20150408/GIF/1198396-46-1.gif)




