A1520912
2,2'-Bipyridine-3,3'-dicarboxylic Acid , >98.0% , 4433-01-6
CAS NO.:4433-01-6
Empirical Formula: C12H8N2O4
Molecular Weight: 244.2
MDL number: MFCD00226068
EINECS: 626-820-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB59.20 | In Stock |
|
| 5G | RMB179.20 | In Stock |
|
| 25g | RMB494.40 | In Stock |
|
| 100g | RMB1886.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 261°C(dec.)(lit.) |
| Boiling point: | 454.1±40.0 °C(Predicted) |
| Density | 1.469±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 1.40±0.36(Predicted) |
| color | White to Almost white |
| InChI | 1S/C12H8N2O4/c15-11(16)7-3-1-5-13-9(7)10-8(12(17)18)4-2-6-14-10/h1-6H,(H,15,16)(H,17,18) |
| InChIKey | KNVZVRWMLMPTTJ-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cccnc1-c2ncccc2C(O)=O |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





