A1521812
Benzyl 4-Chlorophenyl Ketone , >98.0%(GC) , 1889-71-0
Synonym(s):
4-Chlorodeoxybenzoin
| Pack Size | Price | Stock | Quantity |
| 1g | RMB25.60 | In Stock |
|
| 5G | RMB122.40 | In Stock |
|
| 25G | RMB439.20 | In Stock |
|
| 100g | RMB2193.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 103-107 °C(lit.) |
| Boiling point: | 187°C/8mmHg(lit.) |
| Density | 1.191±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 976443 |
| InChI | InChI=1S/C14H11ClO/c15-13-8-6-12(7-9-13)14(16)10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | DXVALSKCLLBZEB-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(Cl)C=C1)CC1=CC=CC=C1 |
| CAS DataBase Reference | 1889-71-0(CAS DataBase Reference) |
Description and Uses
4'-Chloro-2-phenylacetophenone is used in organic synthesis and experimental research.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H317-H318 |
| Precautionary statements | P280-P302+P352-P305+P351+P338+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,N |
| Risk Statements | 41-43-51/53 |
| Safety Statements | 26-39-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HazardClass | 9 |
| PackingGroup | Ⅲ |
| HS Code | 2914790090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Sens. 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





