![Bis[3,4,6-trichloro-2-(pentyloxycarbonyl)phenyl] Oxalate](https://img.chemicalbook.com/CAS/GIF/30431-54-0.gif)
A1534612
Bis[3,4,6-trichloro-2-(pentyloxycarbonyl)phenyl] Oxalate , >98.0%(HPLC) , 30431-54-0
CAS NO.：30431-54-0
Empirical Formula: C26H24Cl6O8
Molecular Weight: 677.18
MDL number: MFCD00191674
EINECS: 250-195-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB44.00 | In Stock |
|
| 5G | RMB165.60 | In Stock |
|
| 25G | RMB325.60 | In Stock |
|
| 100G | RMB469.60 | In Stock |
|
| 500G | RMB1934.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83 °C |
| Boiling point: | 692.1±55.0 °C(Predicted) |
| Density | 1.434±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Chloroform |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C26H24Cl6O8/c1-3-5-7-9-37-23(33)17-19(31)13(27)11-15(29)21(17)39-25(35)26(36)40-22-16(30)12-14(28)20(32)18(22)24(34)38-10-8-6-4-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | TZZLVFUOAYMTHA-UHFFFAOYSA-N |
| SMILES | C(OC1=C(Cl)C=C(Cl)C(Cl)=C1C(OCCCCC)=O)(=O)C(OC1=C(Cl)C=C(Cl)C(Cl)=C1C(OCCCCC)=O)=O |
| EPA Substance Registry System | Ethanedioic acid, bis[3,4,6-trichloro-2-[(pentyloxy)carbonyl]phenyl] ester (30431-54-0) |
Description and Uses
Bis[3,4,6-trichloro-2-(pentyloxycarbonyl)phenyl] oxalate is a fluorescent dye that can be used for generation of chemiluminescence[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P362+P364-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| Risk Statements | 23/24/25 |
| Safety Statements | 36/37/39 |
| WGK Germany | 3 |
| F | 8-21 |
| HS Code | 2934.20.8000 |
