A1544312
6-Bromoindazole , >98.0% , 79762-54-2
CAS NO.：79762-54-2
Empirical Formula: C7H5BrN2
Molecular Weight: 197.03
MDL number: MFCD03265457
EINECS: 626-742-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB54.40 | In Stock |
|
| 25G | RMB175.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-182 |
| Boiling point: | 333.8±15.0 °C(Predicted) |
| Density | 1.770±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 12.78±0.40(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C7H5BrN2/c8-6-2-1-5-4-9-10-7(5)3-6/h1-4H,(H,9,10) |
| InChIKey | WMKDUJVLNZANRN-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(Br)=C2)C=N1 |
| CAS DataBase Reference | 79762-54-2(CAS DataBase Reference) |
Description and Uses
6-Bromo-1H-indazole is an indazole derivative being studied as an inhibitor of DNA gyrase B and its antibacterial activity.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H302-H318-H335 |
| Precautionary statements | P261-P280a-P304+P340-P405-P501a-P280-P305+P351+P338-P264-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-36/37-39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
