A1544912
4-Bromo-2-fluorobenzoic Acid , 98% , 112704-79-7
CAS NO.:112704-79-7
Empirical Formula: C7H4BrFO2
Molecular Weight: 219.01
MDL number: MFCD00143263
EINECS: 630-232-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB97.60 | In Stock |
|
| 100G | RMB275.20 | In Stock |
|
| 500G | RMB1304.80 | In Stock |
|
| 1kg | RMB2503.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 211-215 °C (lit.) |
| Boiling point: | 289.4±25.0 °C(Predicted) |
| Density | 1.7218 (rough estimate) |
| refractive index | 1.4240 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Solubility in methanol, very faint turbidity. |
| form | Solid |
| pka | 3.04±0.10(Predicted) |
| color | White |
| BRN | 6323931 |
| InChI | InChI=1S/C7H4BrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11) |
| InChIKey | ZQQSRVPOAHYHEL-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Br)C=C1F |
| CAS DataBase Reference | 112704-79-7(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 4-bromo-2-fluoro- (112704-79-7) |
Description and Uses
4-Bromo-2-fluorobenzoic acid may be used in the synthesis of biaryl intermediates by palladium-mediated coupling with various aryl boronic acids
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |






![4-[1-(4-cyano-3-trifluoromethyl-phenylcarbamoyl)-1-methyl-ethylamino]-2-fluoro-N-](https://img.chemicalbook.com/CAS/20210111/GIF/1289942-55-7.gif)
