A1549012
Benzil Dioxime , >98.0% , 23873-81-6
Synonym(s):
α-Benzil dioxime
CAS NO.:23873-81-6
Empirical Formula: C14H12N2O2
Molecular Weight: 240.26
MDL number: MFCD00002113
EINECS: 245-921-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB185.60 | In Stock |
|
| 100G | RMB695.20 | In Stock |
|
| 500G | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 237-240 °C (dec.) (lit.) |
| Boiling point: | 382.97°C (rough estimate) |
| Density | 1.1613 (rough estimate) |
| refractive index | 1.6180 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| pka | 9.70±0.28(Predicted) |
| color | White to Orange to Green |
| Merck | 14,1079 |
| BRN | 2053615 |
| InChI | InChI=1S/C14H12N2O2/c17-15-13(11-7-3-1-4-8-11)14(16-18)12-9-5-2-6-10-12/h1-10,17-18H |
| InChIKey | JJZONEUCDUQVGR-WXUKJITCSA-N |
| SMILES | C(=NO)(C1=CC=CC=C1)C(=NO)C1=CC=CC=C1 |
| CAS DataBase Reference | 23873-81-6(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanedione, diphenyl-, dioxime (23873-81-6) |
Description and Uses
anti-Diphenylglyoxime (α-Benzil dioxime) was used as a chelating agent in differential pulse adsorptive stripping voltammetric (DPASV) determination of cobalt in vegetable animal foodstuffs.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | DD1985000 |
| TSCA | Yes |
| HS Code | 29280000 |







