A1553112
1,3-Bis(trifluoromethyl)benzene , >98.0%(GC) , 402-31-3
Synonym(s):
α,α,α,α′,α′,α′-Hexafluoro-m-xylene
CAS NO.：402-31-3
Empirical Formula: C8H4F6
Molecular Weight: 214.11
MDL number: MFCD00000392
EINECS: 206-939-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB28.80 | In Stock |
|
| 50g | RMB47.20 | In Stock |
|
| 100G | RMB56.00 | In Stock |
|
| 250g | RMB135.20 | In Stock |
|
| 500G | RMB189.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -35°C |
| Boiling point: | 116-116.3 °C(lit.) |
| Density | 1.378 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 26 °C |
| storage temp. | Sealed in dry,2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.378 |
| Water Solubility | Insoluble in water. Soluble in alcohol, ether, benzene. |
| BRN | 2052589 |
| Dielectric constant | 5.9800000000000004 |
| InChI | 1S/C8H4F6/c9-7(10,11)5-2-1-3-6(4-5)8(12,13)14/h1-4H |
| InChIKey | SJBBXFLOLUTGCW-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(c1)C(F)(F)F |
| LogP | 3.83 |
| CAS DataBase Reference | 402-31-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,3-bis(trifluoromethyl)-(402-31-3) |
| EPA Substance Registry System | Benzene, 1,3-bis(trifluoromethyl)- (402-31-3) |
Description and Uses
1,3-Bis(trifluoromethyl)benzene undergoes regioselective metalation and subsequent carboxylation at position 2 to give 2,6-bis(trifluoromethyl)benzoic acid. a convenient, selective synthesis of bis[2,4-bis(trifluoromethyl)phenyl]phosphane derivatives with 1,3-bis(trifluoromethyl)benzene as starting material.
Safety
| Symbol(GHS) |    GHS02,GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335-H411 |
| Precautionary statements | P210-P233-P240-P273-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-24/25 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
