A1554012
4-Benzoylbutyric Acid , >96.0% , 1501-05-9
Synonym(s):
4-Benzoylbutyric acid
CAS NO.:1501-05-9
Empirical Formula: C11H12O3
Molecular Weight: 192.21
MDL number: MFCD00004411
EINECS: 216-113-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB92.00 | In Stock |
|
| 10G | RMB127.20 | In Stock |
|
| 25G | RMB282.40 | In Stock |
|
| 100G | RMB1023.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-129 °C(lit.) |
| Boiling point: | 380.8±25.0 °C(Predicted) |
| Density | 1.164±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| form | Crystalline Powder |
| pka | 4.63±0.10(Predicted) |
| color | Off-white to light beige |
| Water Solubility | Insoluble in water. |
| BRN | 641947 |
| InChI | InChI=1S/C11H12O3/c12-10(7-4-8-11(13)14)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,13,14) |
| InChIKey | SHKWSBAVRQZYLE-UHFFFAOYSA-N |
| SMILES | C1(=CC=CC=C1)C(=O)CCCC(=O)O |
| CAS DataBase Reference | 1501-05-9(CAS DataBase Reference) |
Description and Uses
4-Benzoylbutyric acid is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29183000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







