A1554912
Biphenyl-2-carboxylic Acid , >98.0%(HPLC） , 947-84-2
Synonym(s):
2-Phenylbenzoic acid
CAS NO.：947-84-2
Empirical Formula: C13H10O2
Molecular Weight: 198.22
MDL number: MFCD00002463
EINECS: 213-432-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB57.60 | In Stock |
|
| 100G | RMB195.20 | In Stock |
|
| 500G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 111-113 °C(lit.) |
| Boiling point: | 199 °C10 mm Hg(lit.) |
| Density | 1.1184 (rough estimate) |
| refractive index | 1.5954 (estimate) |
| Flash point: | 343-344°C |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.46(at 25℃) |
| form | Crystalline Powder |
| color | White to beige |
| Water Solubility | insoluble |
| BRN | 974075 |
| InChI | InChI=1S/C13H10O2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H,(H,14,15) |
| InChIKey | ILYSAKHOYBPSPC-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=CC=C1C(O)=O |
| CAS DataBase Reference | 947-84-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Biphenylcarboxylic acid(947-84-2) |
Description and Uses
2-Biphenylcarboxylic acid is used in the preparation of neuropeptide FF receptor antagonists. In addition it is used in the synthesis of disubstituted piperidines as orexin receptor antagonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39-37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
