A1559512
2,2-Bis(4-aminophenyl)hexafluoropropane , >98.0%(T) , 1095-78-9
Synonym(s):
2,2-Bis(4-aminophenyl)hexafluoropropane;4,4′-(Hexafluoroisopropylidene)dianiline
CAS NO.:1095-78-9
Empirical Formula: C15H12F6N2
Molecular Weight: 334.26
MDL number: MFCD00039146
EINECS: 206-141-6
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB23.20 | In Stock |
|
| 100mg | RMB47.20 | In Stock |
|
| 1G | RMB331.20 | In Stock |
|
| 5G | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195-198 °C(lit.) |
| Boiling point: | 351.2±42.0 °C(Predicted) |
| Density | 1.3410 (estimate) |
| storage temp. | 2-8°C, protect from light |
| solubility | Slightly soluble[in water] |
| solubility | Soluble in Methanol |
| form | Crystalline Powder |
| pka | 3.98±0.25(Predicted) |
| color | White to light yellow |
| Water Solubility | insoluble |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C15H12F6N2/c16-14(17,18)13(15(19,20)21,9-1-5-11(22)6-2-9)10-3-7-12(23)8-4-10/h1-8H,22-23H2 |
| InChIKey | BEKFRNOZJSYWKZ-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(N)C=C1)(C1=CC=C(N)C=C1)(C(F)(F)F)C(F)(F)F |
| CAS DataBase Reference | 1095-78-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis- (1095-78-9) |
Description and Uses
2,2-Bis(4-aminophenyl)hexafluoropropane is a fluorinated organic monomer compound used in the synthesis of a wide variety of polymers and their derivatives, such as polyimides and polyamides. Polyhydroxylamides are used as carriers for thin film composite membranes for water treatment.
2,2-Bis(4-aminophenyl)hexafluoropropane is used as a reactant in the crosslinking and stabilization of nanoparticle-filled polymethylpentyne nanocomposite membranes for gas separations.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29215900 |
| Storage Class | 11 - Combustible Solids |





