A1560912
6-Bromoindole-2-carboxylic Acid , 97% , 16732-65-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB63.20 | In Stock |
|
| 5G | RMB233.60 | In Stock |
|
| 25g | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 221-223°C |
| Boiling point: | 470.9±25.0 °C(Predicted) |
| Density | 1.838±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 4.30±0.30(Predicted) |
| form | Solid |
| color | White to Light yellow to Light orange |
| λmax | 308nm(EtOH)(lit.) |
| InChI | InChI=1S/C9H6BrNO2/c10-6-2-1-5-3-8(9(12)13)11-7(5)4-6/h1-4,11H,(H,12,13) |
| InChIKey | SVBVYRYROZWKNJ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(Br)=C2)C=C1C(O)=O |
| CAS DataBase Reference | 16732-65-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 36/37/39 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







