A1565412
2-Benzoylbenzoic Acid , >99.0%(T) , 85-52-9
Synonym(s):
Benzophenone-2-carboxylic acid
CAS NO.:85-52-9
Empirical Formula: C14H10O3
Molecular Weight: 226.23
MDL number: MFCD00002472
EINECS: 201-612-2
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 50g | RMB31.20 | In Stock |
|
| 100G | RMB44.00 | In Stock |
|
| 250g | RMB95.20 | In Stock |
|
| 500G | RMB159.20 | In Stock |
|
| 2.5kg | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-129 °C (lit.) |
| Boiling point: | 257-265 °C (lit.) |
| Density | 1.2022 (rough estimate) |
| refractive index | 1.5767 (estimate) |
| Flash point: | 257°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | pK1: 3.54 (25°C) |
| color | Almost white to slightly beige |
| Water Solubility | 284mg/L at 20℃ |
| BRN | 1107841 |
| InChI | 1S/C14H10O3/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17/h1-9H,(H,16,17) |
| InChIKey | FGTYTUFKXYPTML-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccccc1C(=O)c2ccccc2 |
| LogP | 1.4 at 35℃ |
| CAS DataBase Reference | 85-52-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 2-benzoyl-(85-52-9) |
| EPA Substance Registry System | Benzoic acid, 2-benzoyl- (85-52-9) |
Description and Uses
2-Benzoylbenzoic Acid is a reagent that is used in the synthesis of BzATP Triethylammonium Salt, which is a selective P2X purinergic agonist. It is more potent than ATP at homodimeric P2X7 receptors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280g-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 2 |
| RTECS | DG3600000 |
| TSCA | TSCA listed |
| HS Code | 29183000 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 85-52-9(Hazardous Substances Data) |
| Toxicity | LD50 orl-rat: 4600 mg/kg GTPZAB 15(11),52,71 |



