A1574612
2-Bromo-6-methoxyphenol , >98.0% , 28165-49-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB142.40 | In Stock |
|
| 25G | RMB599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-65°C |
| Boiling point: | 146°C/4mmHg(lit.) |
| Density | 1.585±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 8.43±0.10(Predicted) |
| color | White to Light yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C7H7BrO2/c1-10-6-4-2-3-5(8)7(6)9/h2-4,9H,1H3 |
| InChIKey | WEUFQISIJPSTBM-UHFFFAOYSA-N |
| SMILES | C1(O)=C(OC)C=CC=C1Br |
Description and Uses
2-Bromo-6-methoxyphenol is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280g-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37 |
| HazardClass | IRRITANT |
| HS Code | 29095000 |
