A1575412
2-Bromo-4-chlorophenol , >98.0%(GC) , 695-96-5
CAS NO.:695-96-5
Empirical Formula: C6H4BrClO
Molecular Weight: 207.45
MDL number: MFCD00002319
EINECS: 211-785-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB36.80 | In Stock |
|
| 25G | RMB128.00 | In Stock |
|
| 100g | RMB415.20 | In Stock |
|
| 500g | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 31-33 °C (lit.) |
| Boiling point: | 121-123 °C/10 mmHg (lit.) |
| Density | 1.6027 (rough estimate) |
| refractive index | 1.5730 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | methanol: 0.1 g/mL, clear |
| form | powder to lump to clear liquid |
| pka | 7.98±0.18(Predicted) |
| color | White or Colorles to Yellow to Orange |
| BRN | 2042871 |
| InChI | InChI=1S/C6H4BrClO/c7-5-3-4(8)1-2-6(5)9/h1-3,9H |
| InChIKey | ZIYRDJLAJYTELF-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(Cl)C=C1Br |
| CAS DataBase Reference | 695-96-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 2-bromo-4-chloro-(695-96-5) |
Description and Uses
2-Bromo-4-chlorophenol is a reactant in the preparation of 3-(2-(2,4-dichlorophenoxy)ethoxy)-6-methyl-2-nitropyridine selective sphingosine-1-phosphate 4 receptor (S1P4-R) agonist.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-28-36/39-24/25 |
| RIDADR | UN 2020 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29081000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







