A1577112
Benzyl Carbamate , >97.0% , 621-84-1
CAS NO.:621-84-1
Empirical Formula: C8H9NO2
Molecular Weight: 151.16
MDL number: MFCD00007965
EINECS: 210-710-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB40.00 | In Stock |
|
| 100G | RMB103.20 | In Stock |
|
| 250G | RMB247.20 | In Stock |
|
| 500G | RMB468.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-89 °C (lit.) |
| Boiling point: | 273.17°C (rough estimate) |
| Density | 1.2023 (rough estimate) |
| refractive index | 1.5810 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 13.42±0.50(Predicted) |
| form | Powder or Flakes |
| color | Off-white to light beige |
| Water Solubility | 68.02g/L(37 ºC) |
| BRN | 1865635 |
| InChI | InChI=1S/C8H9NO2/c9-8(10)11-6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10) |
| InChIKey | PUJDIJCNWFYVJX-UHFFFAOYSA-N |
| SMILES | C(OCC1=CC=CC=C1)(=O)N |
| CAS DataBase Reference | 621-84-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Carbamic acid, benzyl ester(621-84-1) |
Description and Uses
Benzyl carbamate is a reagent used for the nucleophilic introduction of an amino-protected group, Benzyl carbamates can be considered as a benzyloxycarbonyl (otherwise known as carbobenzyloxy, Cbz or Z) protecting group for amino groups. It was introduced as a versatile alternative to the ethoxy carbamate group in peptide synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29242995 |
| Storage Class | 11 - Combustible Solids |





