A1583312
3-Butenoic Acid , >98.0%(GC) , 625-38-7
Synonym(s):
Vinylacetic acid
CAS NO.:625-38-7
Empirical Formula: C4H6O2
Molecular Weight: 86.09
MDL number: MFCD00002782
EINECS: 210-892-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5g | RMB68.00 | In Stock |
|
| 25G | RMB256.00 | In Stock |
|
| 100G | RMB956.00 | In Stock |
|
| 500g | RMB3596.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −39 °C(lit.) |
| Boiling point: | 163 °C(lit.) |
| Density | 1.013 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 150 °F |
| storage temp. | 2-8°C |
| solubility | Fully miscible. |
| pka | 4.34(at 25℃) |
| form | Liquid |
| color | Clear colorless to yellow |
| BRN | 1699159 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C4H6O2/c1-2-3-4(5)6/h2H,1,3H2,(H,5,6) |
| InChIKey | PVEOYINWKBTPIZ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CC=C |
| CAS DataBase Reference | 625-38-7(CAS DataBase Reference) |
Description and Uses
3-Butenoic acid was used in the synthesis of polyethylene glycolated boltorn coatings. It was used to study the inhibition of the enzyme-catalysed conversion of D-tyrosyl- phenylalanyl-glycine to D-tyrosyl-phenylaline amide by non-peptide carboxylic acids. It was used in preparation of strained nitroso Diels-Aldrer adducts which undergo a domino ROC metathesis in the presence of Ru-carbene catalysts and olefins.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H314-H335-H341-H351-H412 |
| Precautionary statements | P202-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 22-34-68-43-40 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2922 8/PG 2 |
| WGK Germany | 2 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29161900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Aquatic Chronic 2 Carc. 2 Eye Dam. 1 Muta. 2 Skin Corr. 1B Skin Sens. 1 STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |









