A1590912
4-Butylphenol , >96.0%(GC) , 1638-22-8
CAS NO.:1638-22-8
Empirical Formula: C10H14O
Molecular Weight: 150.22
MDL number: MFCD00041750
EINECS: 216-672-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB58.40 | In Stock |
|
| 25G | RMB220.00 | In Stock |
|
| 100g | RMB780.00 | In Stock |
|
| 500g | RMB3154.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 22°C |
| Boiling point: | 138-139°C 18mm |
| Density | 0,98 g/cm3 |
| refractive index | 1.5170 |
| Flash point: | 245°C |
| storage temp. | RT, stored under nitrogen |
| form | clear liquid |
| pka | 10.11±0.13(Predicted) |
| color | Colorless to Brown |
| Water Solubility | Not miscible with water. |
| BRN | 2042120 |
| InChI | InChI=1S/C10H14O/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3 |
| InChIKey | CYYZDBDROVLTJU-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(CCCC)C=C1 |
| CAS DataBase Reference | 1638-22-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 4-butyl-(1638-22-8) |
| EPA Substance Registry System | p-Butylphenol (1638-22-8) |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H314-H318 |
| Precautionary statements | P260-P264-P270-P271-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501-P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P501a |
| Hazard Codes | C,Xn |
| Risk Statements | 20/21/22-36/37/38-41-34-22 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3145 |
| WGK Germany | WGK 3 |
| RTECS | SJ8922500 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2907199090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





