A1595512
4-Bromobenzenediazonium Tetrafluoroborate , >97.0% , 673-40-5
CAS NO.:673-40-5
Empirical Formula: C6H4BBrF4N2
Molecular Weight: 270.82
MDL number: MFCD00011894
EINECS: 211-608-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB406.40 | In Stock |
|
| 25G | RMB1354.40 | In Stock |
|
| 100g | RMB3996.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135-140 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Yellow to Orange |
| Sensitive | Moisture Sensitive |
| BRN | 3791621 |
| InChI | 1S/C6H4BrN2.BF4/c7-5-1-3-6(9-8)4-2-5;2-1(3,4)5/h1-4H;/q+1;-1 |
| InChIKey | FXTCQUCYDJZGGU-UHFFFAOYSA-N |
| SMILES | F[B-](F)(F)F.Brc1ccc(cc1)[N+]#N |
| CAS DataBase Reference | 673-40-5 |
Description and Uses
4-Bromobenzenediazonium tetrafluoroborate was used in preparation of surface modified Au(111) electrode, 1-(4-bromophenyl)-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodec-1-ene.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | BQ9625000 |
| F | 9-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29270000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |





