A1609312
1,3-Bis(aminomethyl)cyclohexane (<i>cis</i>- and <i>trans</i>- mixture) , >98.0%(GC) , 2579-20-6
Synonym(s):
1,3-Bis(aminomethyl)cyclohexane
CAS NO.:2579-20-6
Empirical Formula: C8H18N2
Molecular Weight: 142.24
MDL number: MFCD00001522
EINECS: 219-941-5
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB23.20 | In Stock |
|
| 25ML | RMB39.20 | In Stock |
|
| 100ML | RMB86.40 | In Stock |
|
| 500ML | RMB317.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -70 °C |
| Boiling point: | 220 °C |
| Density | 0.945 g/mL at 25 °C(lit.) |
| vapor pressure | 34Pa at 25℃ |
| refractive index | n |
| Flash point: | 223 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 10.57±0.29(Predicted) |
| form | Liquid |
| color | Clear colorless |
| Water Solubility | Soluble |
| InChI | InChI=1S/C8H18N2/c9-5-7-2-1-3-8(4-7)6-10/h7-8H,1-6,9-10H2 |
| InChIKey | QLBRROYTTDFLDX-UHFFFAOYSA-N |
| SMILES | C1(CN)CCCC(CN)C1 |
| LogP | 0.783 at 21.5℃ |
| CAS DataBase Reference | 2579-20-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Cyclohexanedimethanamine (2579-20-6) |
Description and Uses
1,3-Cyclohexanebis(methylamine), mixture of isomers (1,3-BAC), is used as a cross-linking agent that can be used in the formation of fiber-based membranes for the separation of CO2. It can also be used in the synthesis of open-framework bimetallic phosphites for potential usage in molecular sieves and ion exchangers.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312-H314-H412 |
| Precautionary statements | P270-P273-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 20/21/22-34-22-52/53-35-21/22 |
| Safety Statements | 26-27-28-36/37/39-45-25-61 |
| RIDADR | UN 2735 8/PG 2 |
| WGK Germany | 3 |
| RTECS | GU7000000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | I |
| HS Code | 29213000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Aquatic Chronic 3 Eye Dam. 1 Skin Corr. 1A |
| Toxicity | LD50 orl-rat: 880 mg/kg HURC** -,-,73 |






