A1616212
2-(4-Bromophenyl)ethyl Alcohol , >97.0%(GC) , 4654-39-1
Synonym(s):
2-(4-Bromophenyl)ethanol
CAS NO.:4654-39-1
Empirical Formula: C8H9BrO
Molecular Weight: 201.06
MDL number: MFCD00002897
EINECS: 225-093-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB51.20 | In Stock |
|
| 25G | RMB215.20 | In Stock |
|
| 100G | RMB791.20 | In Stock |
|
| 500G | RMB3839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36-38 °C(lit.) |
| Boiling point: | 138 °C/9 mmHg (lit.) |
| Density | 1.436 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 146 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| pka | 14.79±0.10(Predicted) |
| color | Clear colorless to light yellow |
| BRN | 2079929 |
| InChI | InChI=1S/C8H9BrO/c9-8-3-1-7(2-4-8)5-6-10/h1-4,10H,5-6H2 |
| InChIKey | PMOSJSPFNDUAFY-UHFFFAOYSA-N |
| SMILES | C1(CCO)=CC=C(Br)C=C1 |
| CAS DataBase Reference | 4654-39-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzeneethanol, 4-bromo-(4654-39-1) |
Description and Uses
4-Bromophenethyl alcohol was used in the synthesis of 4-(4-(3-(trifluoromethyl)-3H-diazirin-3-yl)phenethoxy)quinazoline.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312-H315-H319-H335 |
| Precautionary statements | P261-P264b-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P330-P362+P364-P403+P233-P501c |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 26-24/25 |
| WGK Germany | 3 |
| HS Code | 29052900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral |





