A1616712
2-Bromo-4-nitroanisole , >98.0%(GC) , 5197-28-4
CAS NO.:5197-28-4
Empirical Formula: C7H6BrNO3
Molecular Weight: 232.03
MDL number: MFCD00041242
EINECS: 225-983-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB214.40 | In Stock |
|
| 100g | RMB639.20 | In Stock |
|
| 500g | RMB2559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-106 °C (lit.) |
| Boiling point: | 306.3±22.0 °C(Predicted) |
| Density | 1.640±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Brown |
| BRN | 2556372 |
| InChI | 1S/C7H6BrNO3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,1H3 |
| InChIKey | JMUDXQVNBZCQRF-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1Br)[N+]([O-])=O |
| CAS DataBase Reference | 5197-28-4(CAS DataBase Reference) |
Description and Uses
2-Bromo-4-nitroanisole is mainly used as an organic synthetic raw material or intermediate compound. It can be used to prepare 3-Bromo-4-methoxyaniline and its derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2909309090 |
| Storage Class | 11 - Combustible Solids |






