A1623812
4-Bromothiophene-2-carboxaldehyde , >98.0%(GC) , 18791-75-8
CAS NO.:18791-75-8
Empirical Formula: C5H3BrOS
Molecular Weight: 191.05
MDL number: MFCD00005431
EINECS: 242-577-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB117.60 | In Stock |
|
| 100G | RMB400.00 | In Stock |
|
| 500G | RMB1900.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44-46 °C (lit.) |
| Boiling point: | 114-115 °C/11 mmHg (lit.) |
| Density | 1.770 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | Powder or Granules |
| color | White to beige |
| Sensitive | Air Sensitive |
| BRN | 108455 |
| InChI | InChI=1S/C5H3BrOS/c6-4-1-5(2-7)8-3-4/h1-3H |
| InChIKey | PDONIKHDXYHTLS-UHFFFAOYSA-N |
| SMILES | C1(C=O)SC=C(Br)C=1 |
| CAS DataBase Reference | 18791-75-8(CAS DataBase Reference) |
Description and Uses
4-Bromothiophene-2-carboxaldehyde has been used:
- as building block for the synthesis of tetrahydroisoquinolinones
- in the synthesis of 3-[(4-bromo-2-thienyl)methylenehydrazinocarbonyl]-1H-1,2,4-triazole
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 22-24/25-36/37/39-26-36 |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | N |
| HazardClass | IRRITANT |
| HS Code | 29349990 |




