PRODUCT Properties
| Melting point: | 178° |
| Boiling point: | 402.51°C (rough estimate) |
| Density | 1.2165 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | 2-8°C |
| solubility | Ethanol: soluble |
| form | A solid |
| pka | 7.18±0.40(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C14H13NO4/c1-16-10-5-4-8-11(13(10)18-3)15-14-9(6-7-19-14)12(8)17-2/h4-7H,1-3H3 |
| InChIKey | SLSIBLKBHNKZTB-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C(OC)C=2OC)C(OC)=C2C=COC=12 |
Description and Uses
Skimmianin is an antimicrobial agent extracted from bark Helietta Apiculata Benth (Rutaceae).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |






![2-[2-(Methylamino)benzoyl]-3,4-dihydro-β-carboline-1(2H)-one](https://img.chemicalbook.com/CAS/20150408/GIF/526-43-2.gif)
