A1629550
2-(2-Aminothiazole-4-yl)-2-hydroxyiminoacetate , 97% , 64485-82-1
CAS NO.:64485-82-1
Empirical Formula: C7H9N3O3S
Molecular Weight: 215.23
MDL number: MFCD00010415
EINECS: 264-910-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB102.40 | In Stock |
|
| 25g | RMB293.60 | In Stock |
|
| 100g | RMB957.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195-197 °C(lit.) |
| Boiling point: | 426.8±37.0 °C(Predicted) |
| Density | 1.4565 (rough estimate) |
| refractive index | 1.6630 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 9.53±0.70(Predicted) |
| form | Solid |
| color | Off-White to Light Tan |
| InChI | InChI=1S/C7H9N3O3S/c1-2-13-6(11)5(10-12)4-3-14-7(8)9-4/h3,12H,2H2,1H3,(H2,8,9)/b10-5- |
| InChIKey | BTEPYCPXBCCSDL-YHYXMXQVSA-N |
| SMILES | C(=N/O)(/C(=O)OCC)\C1=CSC(N)=N1 |
| CAS DataBase Reference | 64485-82-1(CAS DataBase Reference) |
Description and Uses
Ethyl 2-amino-α-(hydroxyimino)-4-thiazoleacetate may be used in chemical synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




