A1637012
                    Bromoacetyl Chloride , ≥95% , 22118-09-8
CAS NO.:22118-09-8
Empirical Formula: C2H2BrClO
Molecular Weight: 157.39
MDL number: MFCD00000724
EINECS: 244-790-7
| Pack Size | Price | Stock | Quantity | 
| 5G | RMB65.60 | In Stock | 
                                                 | 
                                        
| 25G | RMB260.80 | In Stock | 
                                                 | 
                                        
| 100G | RMB799.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Boiling point: | 127-128 °C (lit.) | 
                                    
| Density | 1.89 g/mL at 20 °C | 
                                    
| refractive index | n | 
                                    
| storage temp. | 2-8°C | 
                                    
| form | Liquid | 
                                    
| color | Clear yellow to brown | 
                                    
| BRN | 1209323 | 
                                    
| InChI | InChI=1S/C2H2BrClO/c3-1-2(4)5/h1H2 | 
                                    
| InChIKey | SYZRZLUNWVNNNV-UHFFFAOYSA-N | 
                                    
| SMILES | C(Cl)(CBr)=O | 
                                    
| CAS DataBase Reference | 22118-09-8(CAS DataBase Reference) | 
                                    
| NIST Chemistry Reference | Bromoacetyl chloride(22118-09-8) | 
                                    
Description and Uses
Bromoacetyl chloride was used in the synthesis of α,α-disubstituted thioisomünchnones. It was also used in the preparation of 1,3-dibromoacetone.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07  | 
                                    
| Signal word | Danger | 
| Hazard statements | H314-H335 | 
| Precautionary statements | P261-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 | 
| Hazard Codes | C | 
| Risk Statements | 14-34-37 | 
| Safety Statements | 26-36/37/39-45 | 
| RIDADR | UN 3265 8/PG 2 | 
| WGK Germany | 3 | 
| F | 10-21 | 
| HazardClass | 8 | 
| PackingGroup | II | 
| HS Code | 29159000 | 
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | 
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | 






