A1637012
Bromoacetyl Chloride , ≥95% , 22118-09-8
CAS NO.:22118-09-8
Empirical Formula: C2H2BrClO
Molecular Weight: 157.39
MDL number: MFCD00000724
EINECS: 244-790-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB65.60 | In Stock |
|
| 25G | RMB260.80 | In Stock |
|
| 100G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 127-128 °C (lit.) |
| Density | 1.89 g/mL at 20 °C |
| refractive index | n |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear yellow to brown |
| BRN | 1209323 |
| InChI | InChI=1S/C2H2BrClO/c3-1-2(4)5/h1H2 |
| InChIKey | SYZRZLUNWVNNNV-UHFFFAOYSA-N |
| SMILES | C(Cl)(CBr)=O |
| CAS DataBase Reference | 22118-09-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Bromoacetyl chloride(22118-09-8) |
Description and Uses
Bromoacetyl chloride was used in the synthesis of α,α-disubstituted thioisomünchnones. It was also used in the preparation of 1,3-dibromoacetone.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P261-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 14-34-37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29159000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






