PRODUCT Properties
| Melting point: | 74.5-77.5 °C(lit.) |
| Boiling point: | 347.5°C (rough estimate) |
| Density | 1.4245 (rough estimate) |
| refractive index | 1.5130 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| Appearance | White to light yellow Solid |
| InChI | InChI=1S/C13H9BrO/c14-12-8-4-7-11(9-12)13(15)10-5-2-1-3-6-10/h1-9H |
| InChIKey | XNUMUNIJQMSNNN-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC(Br)=C1)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 1016-77-9(CAS DataBase Reference) |
Description and Uses
3-Bromobenzophenone reacts with diphenylmethane to yield the bromo-TPE intermediate mTPE-Br, which serves as a building block for tetraphenylethylene-based derivatives[2].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |






