A1643812
5-<WBR>Bromo-<WBR>4-<WBR>chloro-<WBR>3-<WBR>indolyl α-<SC>D</SC>-galactopyranoside , 98.0%(HPLC) , 107021-38-5
CAS NO.:107021-38-5
Empirical Formula: C14H15BrClNO6
Molecular Weight: 408.63
MDL number: MFCD00063780
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB440.00 | In Stock |
|
| 100MG | RMB1236.80 | In Stock |
|
| 500mg | RMB4319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230℃ (dec.) |
| alpha | +142~+149 |
| Boiling point: | 673.9±55.0 °C(Predicted) |
| Density | 1.882±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMF: 3 mg/ml; DMSO: 14 mg/ml; Ethanol: Slightly soluble; PBS (pH 7.2): 0.25 mg/ml |
| pka | 12.74±0.70(Predicted) |
| form | White to off-white solid |
| color | White to light yellow |
| optical activity | [α]/D 135.0±5.0°, c = 1 in DMF/H2O 1:1 |
| InChI | InChI=1/C14H15BrClNO6/c15-5-1-2-6-9(10(5)16)7(3-17-6)22-14-13(21)12(20)11(19)8(4-18)23-14/h1-3,8,11-14,17-21H,4H2/t8-,11+,12+,13-,14+/s3 |
| InChIKey | OPIFSICVWOWJMJ-ZQYXXTRKNA-N |
| SMILES | C12C(Cl)=C(C=CC=1NC=C2O[C@@H]1[C@H](O)[C@H]([C@@H](O)[C@@H](CO)O1)O)Br |&1:11,12,14,15,17,r| |
| CAS DataBase Reference | 107021-38-5(CAS DataBase Reference) |
Description and Uses
Substrate for beta-galactosidase
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| WGK Germany | 3 |
| HS Code | 29400090 |





![5-Bromo-4-chloro-3-indolyl β-<small>D</small>-Glucuronide Sodium Salt [for Biochemical Research]](https://img.chemicalbook.com/CAS/GIF/129541-41-9.gif)

