A1647050
POLYSTYRENE-B-POLYBUTADIENE-B-POLYSTYRENE , 9003-55-8
CAS NO.：9003-55-8
Empirical Formula: C36H42X2
Molecular Weight: 474.72
MDL number: MFCD00134010
EINECS: 618-370-2
| Pack Size | Price | Stock | Quantity |
| 100g | RMB82.40 | In Stock |
|
| 500g | RMB256.80 | In Stock |
|
| 1kg | RMB479.20 | In Stock |
|
| 2.5kg | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 253 °C |
| Density | 1.04 g/mL at 25 °C |
| refractive index | 1.57 |
| solubility | solvents with solubility parameters between 7.7 and 9.4: soluble |
| form | slab/chunk |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C8H8.C4H6/c1-2-8-6-4-3-5-7-8;1-3-4-2/h2-7H,1H2;3-4H,1-2H2 |
| InChIKey | MTAZNLWOLGHBHU-UHFFFAOYSA-N |
| SMILES | C(=C)C=C.C(C1C=CC=CC=1)=C |
| LogP | 2.700 (est) |
| IARC | 3 (Vol. 19, Sup 7) 1987 |
| EPA Substance Registry System | Styrene 1,3-butadiene polymer (9003-55-8) |
Description and Uses
Component of hot melt adhesives, sealants, asphalt and oil gels. Modifier for polymers, thermosets and general rubber compounding. Direct molded or extruded auto parts, sporting goods, footware and film.
Safety
| WGK Germany | 3 |
| RTECS | WL6478000 |
| TSCA | TSCA listed |
