A1657450
HyaluronidasefromBovineTestes , ≥400u/mg , 9001-54-1
Synonym(s):
Hyaluronate Lyase from Streptomyces hyalurolyticus
CAS NO.:9001-54-1
Empirical Formula: C18H14O7
Molecular Weight: 342.3
MDL number: MFCD00081705
EINECS: 232-614-1
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB239.20 | In Stock |
|
| 100mg | RMB508.00 | In Stock |
|
| 500mg | RMB1808.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | −20°C |
| form | lyophilized powder |
| color | white to slightly brown |
| Merck | 13,4777 |
| InChI | InChI=1S/C18H14O7/c19-13(11-2-4-15-17(6-11)25-9-23-15)7-12(18(20)21)10-1-3-14-16(5-10)24-8-22-14/h1-6,12H,7-9H2,(H,20,21) |
| InChIKey | PPEBBOHQEAQKSW-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(C1=CC=C2OCOC2=C1)CC(C1=CC=C2OCOC2=C1)=O |
| EPA Substance Registry System | Hyaluronidase (9001-54-1) |
Description and Uses
Pharmaceutic aid (diffusing agent in s.c. injections).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 35079090 |



![Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)europium(III) [NMR Shift Reagent]](https://img.chemicalbook.com/CAS/GIF/15522-71-1.gif)

