A1679212
4-<WBR>Bromo-<WBR>2,3,5,6-<WBR>tetrafluorobenzonitrile , 97% , 17823-40-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB117.60 | In Stock |
|
| 1g | RMB283.20 | In Stock |
|
| 5G | RMB912.80 | In Stock |
|
| 25g | RMB3412.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-79 °C (lit.) |
| Boiling point: | 99 °C(Press: 15 Torr) |
| Density | 1.91±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| color | White |
| InChI | 1S/C7BrF4N/c8-3-6(11)4(9)2(1-13)5(10)7(3)12 |
| InChIKey | STJZOKCIEOTPDV-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(C#N)c(F)c(F)c1Br |
Description and Uses
4-Bromo-2,3,5,6-tetrafluorobenzonitrile may be used in chemical synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2926907090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






