A1683012
4-<WBR>Bromo-<WBR>2,3,5,6-<WBR>tetrafluoroaniline , 98% , 1998-66-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB175.20 | In Stock |
|
| 5G | RMB615.20 | In Stock |
|
| 25g | RMB2159.20 | In Stock |
|
| 100g | RMB6079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 59-61 °C (lit.) |
| Boiling point: | 104-106 °C(Press: 15 Torr) |
| Density | 1.955±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | -0.92±0.10(Predicted) |
| form | solid |
| color | Pale beige |
| InChI | InChI=1S/C6H2BrF4N/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H2 |
| InChIKey | LZUYSMHNMFCPBF-UHFFFAOYSA-N |
| SMILES | C1(N)=C(F)C(F)=C(Br)C(F)=C1F |
| CAS DataBase Reference | 1998-66-9(CAS DataBase Reference) |
Description and Uses
The decomposition of 4-bromo-2,3,5,6-tetrafluoroaniline by pentyl nitrite yields the corresponding aryl radicals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2921420090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







