A1683712
Boc-α-Me-<SC>DL</SC>-Pro-OH , 96.0%(HPLC) , 203869-80-1
Synonym(s):
1-Boc-2-methyl-2-pyrrolidinecarboxylic acid;Boc-α-methyl-DL -proline
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB511.20 | In Stock |
|
| 250MG | RMB718.40 | In Stock |
|
| 500MG | RMB727.20 | In Stock |
|
| 1G | RMB1447.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 91-94 °C |
| Boiling point: | 337.8±35.0 °C(Predicted) |
| Density | 1.160±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 4.20±0.20(Predicted) |
| form | solid |
| color | Off-white |
| BRN | 5869143 |
| InChI | InChI=1S/C11H19NO4/c1-10(2,3)16-9(15)12-7-5-6-11(12,4)8(13)14/h5-7H2,1-4H3,(H,13,14) |
| InChIKey | YQXRKJHVAUKXRN-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCCC1(C)C(O)=O |
Description and Uses
1-(tert-Butoxycarbonyl)-2-methylpyrrolidine-2-carboxylic Acid is a useful research chemical used in the sysnthesis of a novel cyclic nitrone spin trap attached to a phosphonium group in relation to suitable trap for mitochondria-generated ROS.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
