A1702812
2-<WBR>(Boc-<WBR>aminomethyl)<WBR>phenylacetic acid , 97% , 40851-66-9
CAS NO.：40851-66-9
Empirical Formula: C14H19NO4
Molecular Weight: 265.3
MDL number: MFCD06656428
EINECS: 637-014-7
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB95.20 | In Stock |
|
| 1G | RMB312.00 | In Stock |
|
| 500MG | RMB319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 435.2±33.0 °C(Predicted) |
| Density | 1.163±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 4.26±0.10(Predicted) |
| Appearance | White to off-white Solid |
| BRN | 1080474 |
| Major Application | peptide synthesis |
| InChI | 1S/C14H19NO4/c1-14(2,3)19-13(18)15-9-11-7-5-4-6-10(11)8-12(16)17/h4-7H,8-9H2,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | CGPQRFCFBISLKF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCc1ccccc1CC(O)=O |
| CAS DataBase Reference | 40851-66-9(CAS DataBase Reference) |
Description and Uses
[2-(tert-Butoxycarbonylaminomethyl)phenyl]acetic Acid is used to study molecular modeling on oligomers built from 2-aminomethylphenylacetic acid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
