A1788012
5-bromo-pyrimidine-2-carbonitile , 97% , 38275-57-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB54.40 | In Stock |
|
| 5G | RMB104.00 | In Stock |
|
| 25g | RMB428.80 | In Stock |
|
| 100g | RMB1684.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 317.7±34.0 °C(Predicted) |
| Density | 1.86±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| pka | -4.65±0.22(Predicted) |
| form | Solid |
| color | White to yellow |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C5H2BrN3/c6-4-2-8-5(1-7)9-3-4/h2-3H |
| InChIKey | VPQICCOHFSGBMA-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=C(Br)C=N1 |
| CAS DataBase Reference | 38275-57-9(CAS DataBase Reference) |
Description and Uses
5-Bromo-2-cyanopyrimidine is an important raw material and intermediate used in organic synthesis, pharmaceuticals and agrochemicals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn,N |
| Risk Statements | 20/21/22-37/38-41-50 |
| Safety Statements | 26-36/37-39-61 |
| RIDADR | 3077 |
| Hazard Note | Irritant |
| TSCA | No |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |
