A1830812
4-Bromo-2-methoxypyridine , 97% , 100367-39-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB55.20 | In Stock |
|
| 5G | RMB191.20 | In Stock |
|
| 25G | RMB615.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25-26℃ |
| Boiling point: | 87℃/15mm |
| Density | 1.530±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 3.76±0.10(Predicted) |
| form | Low Melting Solid |
| color | Off-white to pale yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C6H6BrNO/c1-9-6-4-5(7)2-3-8-6/h2-4H,1H3 |
| InChIKey | YFTGMMXMLPTTAY-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC=CC(Br)=C1 |
Description and Uses
4-Bromo-2-methoxypyridine used in the synhesis of Imidazo [1, 2-a] pyrimidines. Suzuki coupling between 4-methoxyphenylboronic acid and 4-bromo-2-methoxypyridine affords 1, 5-disubstituted pyridones. Starting material used in a synthesis of crown-ester-bipyridines and viologens via sodium or nickel reductive coupling, side chain oxidation and esterification.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| HS Code | 29339900 |
