A1916212
3-Bromo-2-fluorobenzaldehyde , 98% , 149947-15-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB40.00 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB279.20 | In Stock |
|
| 100g | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 43-46°C |
| Boiling point: | 233.7±20.0 °C(Predicted) |
| Density | 1.670±0.06 g/cm3(Predicted) |
| Flash point: | >110°(230°F) |
| storage temp. | Inert atmosphere,2-8°C |
| form | Powder |
| color | Off-white |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C7H4BrFO/c8-6-3-1-2-5(4-10)7(6)9/h1-4H |
| InChIKey | OUAZPCKRSSEQKB-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=CC(Br)=C1F |
| CAS DataBase Reference | 149947-15-9 |
Description and Uses
It can be used as pharmaceutical raw material and intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2913000090 |
