A1926812
5-Bromo-1,3-dichloro-2-fluorobenzene , 96% , 17318-08-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.80 | In Stock |
|
| 5g | RMB71.20 | In Stock |
|
| 25G | RMB208.00 | In Stock |
|
| 100G | RMB566.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 234℃ |
| Density | 1.823 |
| vapor pressure | 23.8-112Pa at 30-50℃ |
| refractive index | 1.567 |
| Flash point: | 96℃ |
| storage temp. | Sealed in dry,2-8°C |
| form | Liquid |
| Appearance | Colorless to off-white <23°C Solid,>29°C Liquid |
| InChI | InChI=1S/C6H2BrCl2F/c7-3-1-4(8)6(10)5(9)2-3/h1-2H |
| InChIKey | MMJSIYGLDQNUTH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC(Br)=CC(Cl)=C1F |
| LogP | 4.4 at 20℃ and pH7 |
| CAS DataBase Reference | 17318-08-0 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2903998090 |
