A1963112
4-Bromo-2,5-dimethoxybenzaldehyde , 97% , 31558-41-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB119.20 | In Stock |
|
| 25G | RMB553.60 | In Stock |
|
| 100G | RMB2077.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-135°C |
| Boiling point: | 337.1±42.0 °C(Predicted) |
| Density | 1.482±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | solid |
| color | Faint yellow to yellow |
| Water Solubility | Insoluble in water. |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C9H9BrO3/c1-12-8-4-7(10)9(13-2)3-6(8)5-11/h3-5H,1-2H3 |
| InChIKey | BIFWGDWGCZLCHF-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(OC)=C(Br)C=C1OC |
Description and Uses
4-Bromo-2,5-dimethoxybenzene is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2913000090 |
