A1978512
1-Bromo-2-chloro-3-nitrobenzene , 95% , 3970-37-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB56.00 | In Stock |
|
| 1G | RMB152.00 | In Stock |
|
| 5G | RMB683.20 | In Stock |
|
| 25G | RMB2010.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57-60°C |
| Boiling point: | 290.4±20.0 °C(Predicted) |
| Density | 1.827±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Pale Yellow |
| InChI | InChI=1S/C6H3BrClNO2/c7-4-2-1-3-5(6(4)8)9(10)11/h1-3H |
| InChIKey | JNIDAGAFFKAPRV-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC([N+]([O-])=O)=C1Cl |
Description and Uses
1-Bromo-2-chloro-3-nitrobenzene is a reagent used in pharmaceutical synthesis. Used in the synthesis of benzodiazepinone bromodomain inhibitor CPI-637 which may be applicable to cancer therapies.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2902900000 |





![1-Bromo-3-methylimidazo[1,5-a]pyrazine](https://img.chemicalbook.com/CAS/GIF/56481-29-9.gif)

