A2003912
3-Bromo-4-chlorotoluene , 98% , 57310-39-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB72.00 | In Stock |
|
| 25G | RMB144.80 | In Stock |
|
| 100G | RMB426.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 112 °C |
| Density | 1,55 g/cm3 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol (Slightly) |
| form | liquid |
| color | Colourless |
| Specific Gravity | 1.55 |
| InChI | InChI=1S/C7H6BrCl/c1-5-2-3-7(9)6(8)4-5/h2-4H,1H3 |
| InChIKey | UWXPTVKKHVOZLJ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(C)C=C1Br |
| CAS DataBase Reference | 57310-39-1(CAS DataBase Reference) |
Description and Uses
2-Bromo-1-chloro-4-methyl-benzene is a useful synthetic intermediate. It can be used to synthesize N-heterocycle-fused phenanthridines via palladium-catalyzed tandem N-H/C-H arylation of aryl-N-heteroarenes with dihaloarenes. It can also be used to synthesize substituted fluorenes.
Safety
| Symbol(GHS) | ![]() ![]() GHS06, GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H411 |
| Precautionary statements | P273-P301+P310 |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 22-51/53 |
| Safety Statements | 61 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2903998090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 2 |








