A2064312
3-Bromo-6-chloro-2-fluoropyridine , 95% , 885952-18-1
CAS NO.：885952-18-1
Empirical Formula: C5H2BrClFN
Molecular Weight: 210.43
MDL number: MFCD06798230
EINECS: 256-495-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB104.00 | In Stock |
|
| 1G | RMB242.40 | In Stock |
|
| 5G | RMB748.80 | In Stock |
|
| 25g | RMB2689.60 | In Stock |
|
| 100g | RMB12559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 212.0±35.0 °C(Predicted) |
| Density | 1.829±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -4.84±0.10(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C5H2BrClFN/c6-3-1-2-4(7)9-5(3)8/h1-2H |
| InChIKey | VKBRLJKCZACHPU-UHFFFAOYSA-N |
| SMILES | C1(F)=NC(Cl)=CC=C1Br |
Description and Uses
3-Bromo-6-chloro-2-fluoropyridine is a polysubstituted pyridine compound that contains bromine, chlorine and fluorine atom substituents on the benzene ring. It can be used in the preparation of aryl or aza-heteroaryl compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PackingGroup | III |
| HS Code | 2933399990 |
