A2102112
2-Bromo-3-chloroaniline , 98% , 96558-73-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB124.80 | In Stock |
|
| 25G | RMB559.20 | In Stock |
|
| 100g | RMB1897.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41-43℃ |
| Boiling point: | 277℃ |
| Density | 1.722 |
| Flash point: | 122℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | crystalline solid |
| pka | 1.48±0.10(Predicted) |
| color | Light to dark brown |
| InChI | InChI=1S/C6H5BrClN/c7-6-4(8)2-1-3-5(6)9/h1-3H,9H2 |
| InChIKey | JHHMLFBYFNAPDZ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(Cl)=C1Br |
Description and Uses
2-Bromo-3-chloroaniline is a bromoderivative that is used as an electron detector in gas chromatography. It can also be used as an indicator for bromination reactions.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P337+P313-P305+P351+P338-P361+P364-P332+P313-P301+P310+P330-P302+P352+P312-P304+P340+P311-P403+P233-P405 |
| RIDADR | 2811 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 2921420090 |
