A2104212
1-Bromo-2-methylbutane , 95% , 10422-35-2
CAS NO.：10422-35-2
Empirical Formula: C5H11Br
Molecular Weight: 151.04
MDL number: MFCD00000218
EINECS: 600-538-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB47.20 | In Stock |
|
| 25G | RMB93.60 | In Stock |
|
| 100G | RMB228.00 | In Stock |
|
| 500G | RMB779.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -105.4°C (estimate) |
| Boiling point: | 122.93°C (estimate) |
| Density | 1.2140 |
| refractive index | 1.4426 |
| Flash point: | 22 °C |
| InChI | InChI=1S/C5H11Br/c1-3-5(2)4-6/h5H,3-4H2,1-2H3 |
| InChIKey | XKVLZBNEPALHIO-UHFFFAOYSA-N |
| SMILES | C(C)(CBr)CC |
| CAS DataBase Reference | 10422-35-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Butane, 1-bromo-2-methyl-(10422-35-2) |
| EPA Substance Registry System | Butane, 1-bromo-2-methyl-(10422-35-2) |
Description and Uses
1-Bromo-2-methylbutane is a reactant used in the preparation of a chiral diazenes. Also used in the synthesis of high-performance solar cell copolymers.
Safety
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN1993 |
| HazardClass | 3 |
| PackingGroup | II |
