A2177912
Boron trifluoride dibutyl etherate , BF3:30.0-35.0% , 593-04-4
Synonym(s):
Boron trifluoride butyl ether;Boron trifluoride butyl etherate;Dibutyl ether-boron trifluoride;Trifluoroboron dibutyl etherate
CAS NO.：593-04-4
Empirical Formula: C8H18BF3O
Molecular Weight: 198.03
MDL number: MFCD00013195
EINECS: 209-783-5
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB52.00 | In Stock |
|
| 25ML | RMB118.40 | In Stock |
|
| 100ML | RMB316.00 | In Stock |
|
| 500ml | RMB972.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 0.959 g/mL at 25 °C(lit.) |
| Flash point: | 158 °F |
| form | Liquid |
| color | Pale yellow to brown |
| InChI | 1S/C8H18BF3O/c1-3-5-7-13(8-6-4-2)9(10,11)12/h3-8H2,1-2H3 |
| InChIKey | SLFVZPFCQQKCNX-UHFFFAOYSA-N |
| SMILES | CCCC[O+](CCCC)[B-](F)(F)F |
| CAS DataBase Reference | 593-04-4 |
| EPA Substance Registry System | Boron, trifluoro[1,1'-oxybis[butane]]-, (T-4)- (593-04-4) |
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H314 |
| Precautionary statements | P261-P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | T |
| Risk Statements | 23/24/25-34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3264 8/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29310099 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Skin Corr. 1B |
