A2189512
5-Bromo-3-methylbenzene-1,2-diamine , 98% , 76153-06-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB31.20 | In Stock |
|
| 1G | RMB63.20 | In Stock |
|
| 5g | RMB208.00 | In Stock |
|
| 25g | RMB871.20 | In Stock |
|
| 100g | RMB3292.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 63 °C |
| Boiling point: | 298.8±35.0 °C(Predicted) |
| Density | 1.589±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 3.31±0.10(Predicted) |
| Appearance | Brown to dark brown Solid |
| InChI | InChI=1S/C7H9BrN2/c1-4-2-5(8)3-6(9)7(4)10/h2-3H,9-10H2,1H3 |
| InChIKey | UOFSLKHZOPVGHG-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(Br)=CC(C)=C1N |
| CAS DataBase Reference | 76153-06-5 |
Description and Uses
5-Bromo-3-methylbenzene-1,2-diamine is used as an intermediate in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| HazardClass | IRRITANT |
| HS Code | 2921599090 |
