Cytidine , Used for cell culture, ≥99.0%(HPLC) , 65-46-3
Synonym(s):
Cytosine β-D -riboside;Cytosine-1-β-D -ribofuranoside
CAS NO.:65-46-3
Empirical Formula: C9H13N3O5
Molecular Weight: 243.22
MDL number: MFCD00006545
EINECS: 200-610-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB93.60 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 210-220 °C (dec.) (lit.) |
| Boiling point: | 386.09°C (rough estimate) |
| alpha | 31.5 º (c=0.6, H2O 25 ºC) |
| Density | 1.3686 (rough estimate) |
| refractive index | 34 ° (C=0.7, H2O) |
| storage temp. | 2-8°C |
| solubility | H2O: 50 mg/mL |
| form | powder |
| pka | 4.22, 12.5(at 25℃) |
| color | White to almost white |
| PH | 4.13 |
| biological source | synthetic |
| optical activity | [α]20/D +33°, c = 2 in H2O |
| Water Solubility | SOLUBLE |
| Sensitive | Hygroscopic |
| λmax | 280 (pH 1);229.5,271 (pH 7) |
| Merck | 14,2786 |
| BRN | 89173 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Protect from moisture. |
| Cosmetics Ingredients Functions | SKIN PROTECTING SKIN CONDITIONING |
| InChI | 1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | UHDGCWIWMRVCDJ-XVFCMESISA-N |
| SMILES | NC1=NC(=O)N(C=C1)[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O |
| LogP | -1.808 (est) |
| CAS DataBase Reference | 65-46-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Cytidine(65-46-3) |
| EPA Substance Registry System | Cytidine (65-46-3) |
Description and Uses
Cytidine is a pyrimidine nucleoside that is composed of the pyrimidine base cytosine attached to the sugar ribose. As a constituent of RNA, cytidine pairs with guanine, and it is a precursor of uridine. Cytidine can incur several modifications in mRNA, including methylation and acetylation, that function to regulate translation. Cytidine can also be formylated to 5-formylcytidine in mitochondrial methionine transfer RNA (tRNAMet).
Cytidine is a nucleoside molecule that is formed when cytosine is attached to a ribose ring, cytidine is a component of RNA. It was isolated from yeast nucleic acid. It can increases cell membrane phospholipids. Cytidine is used to synthesize enzyme inhibitors, antiviral agents, and anticancer agents. And also used as constituent of nucleic acids.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 68 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | UW7370000 |
| F | 10-23 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 intraperitoneal in mouse: 2700mg/kg |




