A2256812
1,1-Cyclohexanediacetic acid , 98% , 4355-11-7
Synonym(s):
(1-Carboxymethyl-cyclohexyl)-acetic acid;1,1-Bis(carboxymethyl)cyclohexane;2,2′-(Cyclohexane-1,1-diyl)diacetic acid
CAS NO.:4355-11-7
Empirical Formula: C10H16O4
Molecular Weight: 200.23
MDL number: MFCD00040292
EINECS: 224-427-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 10G | RMB35.20 | In Stock |
|
| 25G | RMB59.20 | In Stock |
|
| 50G | RMB97.60 | In Stock |
|
| 250G | RMB259.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181-185 °C (lit.) |
| Boiling point: | 297.96°C (rough estimate) |
| Density | 1.1508 (rough estimate) |
| refractive index | 1.4459 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | pK1:3.49 ;pK2:6.96 (25°C) |
| color | White to Off-White |
| InChI | InChI=1S/C10H16O4/c11-8(12)6-10(7-9(13)14)4-2-1-3-5-10/h1-7H2,(H,11,12)(H,13,14) |
| InChIKey | YQPCHPBGAALCRT-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)(CC(O)=O)CCCCC1 |
| LogP | 1.2 at 21.9℃ |
| CAS DataBase Reference | 4355-11-7(CAS DataBase Reference) |
Description and Uses
1,1-Cyclohexanediacetic Acid (cas# 4355-11-7) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26-36 |
| WGK Germany | 3 |
| HS Code | 29172000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



