PRODUCT Properties
| Melting point: | >258°C (dec.) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| color | Orange to Dark Orange |
| Stability: | Hygroscopic |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | InChI=1S/C19H14NO4.ClH/c1-2-16-19(24-10-21-16)14-8-20-4-3-12-6-17-18(23-9-22-17)7-13(12)15(20)5-11(1)14;/h1-2,5-8H,3-4,9-10H2;1H/q+1;/p-1 |
| InChIKey | LUXPUVKJHVUJAV-UHFFFAOYSA-M |
| SMILES | C12=CC3=C(C4OCOC=4C=C3)C=[N+]1CCC1C=C3OCOC3=CC2=1.[Cl-] |
Description and Uses
Coptisine is an alkaloid found in Chinese goldthread (Coptis chinensis). A bacterial collagenase inhibitor. Coptisine has been found to reversibly inhibit Monoamine oxidase A in mice, pointing to a potential role as a natural antidepressant.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS06 |
| Signal word | Danger |
| Hazard statements | H373-H301-H330-H311 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501-P260-P314-P501-P280-P302+P352-P312-P322-P361-P363-P405-P501-P260-P271-P284-P304+P340-P310-P320-P403+P233-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 2 Oral |





