A2259212
2-Chloroisonicotinic Acid , 97% , 6313-54-8
Synonym(s):
2-Chloroisonicotinic acid
CAS NO.:6313-54-8
Empirical Formula: C6H4ClNO2
Molecular Weight: 157.55
MDL number: MFCD00191402
EINECS: 613-143-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB72.80 | In Stock |
|
| 100G | RMB226.40 | In Stock |
|
| 500g | RMB912.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 246 °C (dec.)(lit.) |
| Boiling point: | 417.7±25.0 °C(Predicted) |
| Density | 1.470±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| pka | 3.00±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to beige |
| BRN | 115861 |
| InChI | InChI=1S/C6H4ClNO2/c7-5-3-4(6(9)10)1-2-8-5/h1-3H,(H,9,10) |
| InChIKey | QXCOHSRHFCHCHN-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(C(O)=O)=C1 |
| CAS DataBase Reference | 6313-54-8(CAS DataBase Reference) |
Description and Uses
Used in monocomposite films.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37/39 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







